On Target MTOR_HUMAN 0.29608938/CHEMBL4059778
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.29608938, the most similar ligand is CHEMBL4059778. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL4059778 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | NC(=N)NS(=O)(=O)c1ccc(NC(=O)Nc2ccc(cc2)c3nc(N4CCOCC4)c5cccnc5n3)cc1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0001c016 00802820 81087100 9ab90e40 010400b0 00004000 00009000 00082c09 10000100 10000842 002d2004 e0009800 06009802 00908041 80221048 120c010c 10042400 02006000 08600000 00606000 c0102100 1805a460 32826040 8840011c 00100400 80000000 48008080 000000ec 0000860c 20460401 c0001800 000143e0 |