On Target MTOR_HUMAN 0.33854166/CHEMBL4059778
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.33854166, the most similar ligand is CHEMBL4059778. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL4059778 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | NC(=N)NS(=O)(=O)c1ccc(NC(=O)Nc2ccc(cc2)c3nc(N4CCOCC4)c5cccnc5n3)cc1 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0001c016 00802820 81087100 9ab90e40 010400b0 00004000 00009000 00082c09 10000100 10000842 002d2004 e0009800 06009802 00908041 80221048 120c010c 10042400 02006000 08600000 00606000 c0102100 1805a460 32826040 8840011c 00100400 80000000 48008080 000000ec 0000860c 20460401 c0001800 000143e0 |