On Target MTOR_HUMAN 0.34146342/CHEMBL2030445
For the given ligand Omeprazole, we have found in our database that, being scored 0.34146342, the most similar ligand is CHEMBL2030445. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL2030445 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | CS(=O)(=O)Cc1cc(nc(n1)c2ccc3[nH]cnc3c2)N4CCOCC4 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 01010002 04000820 c0003500 981d0600 010700e0 00004006 00009008 00080840 10000100 1001485c 0134a004 42009800 04003003 00548000 80021048 000c010c 14040800 02006344 00601000 00600004 42180002 08042020 33804040 00408110 00440400 80000000 28000040 000010a0 0040020c 00660400 40001800 000102e0 |