On Target OPRX_HUMAN 0.39784947/CHEMBL407068
For the given ligand Omeprazole, we have found in our database that, being scored 0.39784947, the most similar ligand is CHEMBL407068. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL407068 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | Fc1cc2nc([nH]c2cc1N3CCNCC3)S(=O)(=O)Cc4cccc(Cl)c4Cl |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 0000c812 04800020 00102722 06192601 20040040 00004030 04008104 00000000 00020100 00404a44 0120a004 40008800 02401006 40443000 80000040 000e0105 04040408 02000108 08200020 00004004 40100000 38040b20 61800020 02c80012 01002000 90108200 00000088 00000083 08008000 00478000 40000000 000302e0 |