On Target CDK5_HUMAN 0.49514562/CHEMBL1967612
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.49514562, the most similar ligand is CHEMBL1967612. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1967612 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | Clc1ccc2c(c1)C(=O)NS2(=O)=O |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008010 08800a00 01080100 01b10600 00080400 10000000 04000001 00001002 00000200 00003840 00102000 60108800 12008804 00000001 a0300000 00000000 02002080 02100000 00400000 00006000 80000000 08028700 00000000 0840000c 02002000 80000004 50000000 0000000c 00000400 20060800 80040000 00030360 |