On Target CDK5_HUMAN 0.34586465/CHEMBL1967612
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.34586465, the most similar ligand is CHEMBL1967612. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL1967612 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | Clc1ccc2c(c1)C(=O)NS2(=O)=O |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00008010 08800a00 01080100 01b10600 00080400 10000000 04000001 00001002 00000200 00003840 00102000 60108800 12008804 00000001 a0300000 00000000 02002080 02100000 00400000 00006000 80000000 08028700 00000000 0840000c 02002000 80000004 50000000 0000000c 00000400 20060800 80040000 00030360 |