On Target ESR1_HUMAN 0.4122807/CHEMBL264655
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.4122807, the most similar ligand is CHEMBL264655. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL264655 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CCCN(c1ccccc1Cl)S(=O)(=O)c2ccc(O)cc2 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000c012 00804008 21100002 01b00600 20080000 00000000 02000020 08000000 00000000 00400840 00202004 60008800 02140406 00000001 802a0040 00020048 00042000 08000000 08400800 00026400 c0100000 18000900 20040040 18410018 02002080 10000404 00000000 0000008c 00008400 20060000 00000000 00030260 |