On Target 5HT2B_HUMAN 0.48076922/CHEMBL333784
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.48076922, the most similar ligand is CHEMBL333784. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL333784 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CC1CCN(CC[C@H]2CCCN2S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008010 01800600 01100000 01b00600 00080000 10000010 00000000 20000000 00000000 004009e0 00202000 70018800 02000006 00000201 80e00000 00000000 00002000 00000000 00402000 00007603 80000000 18000112 00000000 18500018 02002000 0010000c 10000000 1000000c 00000400 20060010 00000000 00132270 |