On Target IKKB_HUMAN 0.35714287/CHEMBL230488
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL230488. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL230488 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | NC(=O)c1cc(cc(c1N)c2ccc(cc2)S(=O)(=O)N)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000a012 00801800 01000100 00b10600 00000009 04010000 00000000 00081004 00000000 00000840 00002004 60008800 02808804 00000001 80220040 08000008 00020000 02003000 04000000 00002000 c0000000 08028700 30000000 0840000c 00002000 80000000 08040000 00000069 10004000 20060000 80040800 41030020 |