On Target MK03_HUMAN 0.29081634/CHEMBL1336
For the given ligand Omeprazole, we have found in our database that, being scored 0.29081634, the most similar ligand is CHEMBL1336. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL1336 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(c3)C(F)(F)F)cc2)ccn1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00008006 44000808 20104108 10010e40 04041020 00100000 02000400 02003009 00000000 00000850 00290004 40008804 02008826 09100000 01024041 2204010c 00040000 02000004 08282000 00060010 40402100 08028700 20822000 00448004 00142000 80000200 000c0040 90200080 00408384 00060001 80140400 02264200 |