On Target NMDZ1_HUMAN 0.28806585/CHEMBL162577
For the given ligand Nefazodone, we have found in our database that, being scored 0.28806585, the most similar ligand is CHEMBL162577. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL162577 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | COc1ccc(cc1)N2C(=O)CN(Cc3c([nH]c4cc(Cl)cc(Cl)c34)C(=O)O)C2=O |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 1001c006 09802808 20000128 14010e10 000c1020 0000c020 06004084 0a003009 00000300 00090a48 01280004 4000a800 060088ae 0070a400 810204c1 020c000c 0006c008 02c0200c 08200040 00020001 c0120100 28078fe8 20822002 8240011e 00146000 c0000400 08044000 80000080 08008304 00060001 e004c200 80424220 |