On Target NMDZ1_HUMAN 0.11888112/CHEMBL248439
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.11888112, the most similar ligand is CHEMBL248439. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL248439 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | COCCN(c1c(Cl)c(Cl)cc2NC(=O)C(=O)Nc12)S(=O)(=O)C |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 0001c022 00008004 00001006 01300620 000c00c0 08000000 08008026 08401000 06040000 00000860 0c242004 40008800 02108c0c 00400001 809e1041 000e004c 0c040000 20000400 08200000 09004000 40140081 18048900 33800000 40210850 820060a2 40100400 18008480 000200ac 04008200 00460000 00040000 004322e0 |