On Target PERM_HUMAN 0.37984496/CHEMBL86
For the given ligand Balsalazide, we have found in our database that, being scored 0.37984496, the most similar ligand is CHEMBL86. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL86 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00008002 88002808 20000108 84010600 00001000 00020100 06000000 02001408 00000000 00110848 08200004 40008800 02008806 08002000 81000441 00002008 00000000 02000400 00000000 00020400 40000000 28028700 20000000 0240000c 00002000 c0000400 00100800 80000000 08000300 00060801 84040000 00020200 |