On Target PERM_HUMAN 0.31924883/CHEMBL2170247
For the given ligand Nefazodone, we have found in our database that, being scored 0.31924883, the most similar ligand is CHEMBL2170247. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL2170247 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CN1C(=O)NC(=O)c2c1nc(NCCN)n2CCCOc3ccccc3 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0401002e 00801808 20280048 02010700 00081060 0200c040 0200a000 00000800 06400100 a08008e0 0c20800c 40019000 04809002 00c02000 01280081 100c200c 00a00000 0008c000 00c00000 00a20000 80000100 7e000040 21804841 00700014 40040000 c0200000 62000200 00040000 09004218 00461800 c0081000 800002c8 |