On Target PERM_HUMAN 0.26209676/CHEMBL3740464
For the given ligand Icatibant, we have found in our database that, being scored 0.26209676, the most similar ligand is CHEMBL3740464. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL3740464 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | Fc1ccc2NC(=S)N(NC(=O)c3ccc(CN4CCCCC4)cc3)C(=O)c2c1 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 0008000e 01000c00 00100100 42010600 02140080 00004030 02010000 22003a00 06284120 400d08e0 05200004 50018000 c0008c02 00601000 00000440 000c0005 10000010 03408000 00600020 00010201 40080100 18038628 62800040 02500214 00100000 e0200000 20010000 90040041 08006180 004f8012 e0040000 80010e88 |