On Target ACES_HUMAN 0.43965518/CHEMBL139353
For the given ligand Balsalazide, we have found in our database that, being scored 0.43965518, the most similar ligand is CHEMBL139353. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL139353 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | Nc1ccc2C(=O)N(CCC3CCN(Cc4ccccc4)CC3)C(=O)c2c1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 10000002 01801800 00100100 90010600 00000000 00008000 00000080 22001000 00800000 000008c0 00200004 50018000 00008802 00200000 00000440 10000000 00002000 02000000 00100000 00000201 c0020000 180686a0 20000000 0050001c 00040000 c0200000 00004000 90000000 00400100 00060001 a0040000 00000200 |