On Target PDE5A_HUMAN 0.45679012/CHEMBL35970
For the given ligand Balsalazide, we have found in our database that, being scored 0.45679012, the most similar ligand is CHEMBL35970. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL35970 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(n2)C(=O)NCCC(=O)O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04000003 00001808 22124109 10010e00 00041021 80124042 42040000 02003201 00000300 00080a40 08290184 44009000 08808802 00110000 01020401 0a0c210e 04008000 02808023 00a00010 00020a00 40000000 18138e20 a1802082 00c0111c 00105001 c0002000 00120050 80801000 00010304 00060003 e0040080 00004600 |