On Target PDE5A_HUMAN 0.4162896/CHEMBL46621
For the given ligand Nefazodone, we have found in our database that, being scored 0.4162896, the most similar ligand is CHEMBL46621. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL46621 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CCCOc1ccc(NC(=O)CN2CCN(C)CC2)cc1C3=Nc4c(C(=O)N3)c(C)nn4C |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0401c006 00000808 60000128 14050e00 85081020 0200c006 02811a00 00080808 06000100 91000af0 8029800c 4001a810 02808026 0050a001 010200c1 000c200c 00248820 2280a000 08400000 00620000 c0100000 3c010640 a1802862 02500016 00042803 80000200 60060020 000c0880 0840c305 00460401 c0004880 400002a0 |