On Target PDE5A_HUMAN 0.44150943/CHEMBL335148
For the given ligand Icatibant, we have found in our database that, being scored 0.44150943, the most similar ligand is CHEMBL335148. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL335148 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CCCCN1C(=O)[C@H]2Cc3c([nH]c4ccccc34)[C@H](N2C1=O)c5ccsc5 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 1001800a 0180fa00 0010090e d5810e10 00141222 00180002 01002404 2300700f 00400880 000908c0 09318204 4080b080 1e00988a 0060a821 000214c0 02040184 00024209 82002027 00300448 0000ca01 c0020100 78a79e88 20804101 93400118 0015f800 e4000001 08004000 d0000004 0e001184 0086000b 200c4200 a0c96e21 |