On Target COMT_HUMAN 0.11111111/CHEMBL3425734
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.11111111, the most similar ligand is CHEMBL3425734. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3425734 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | OC1=CN(C=CC1=O)c2cccc(c2)c3ccccc3 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00002002 00000208 60004100 00010600 00041008 04000004 04000000 00201000 02100000 800008c0 00000004 40018000 00008804 00400000 00000040 0004000c 00020000 02004004 04200000 00060000 40000000 18008010 30800000 81500000 02042400 80080000 08000200 00040040 04404000 00060008 00040000 00200000 |