On Target TRPV1_RAT 0.39130434/CHEMBL1779679
For the given ligand Balsalazide, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL1779679. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL1779679 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | OC(=O)c1cccc(NC(=O)Nc2cccc3ccc(O)cc23)c1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000006 00000808 20000100 00010a40 04000000 00004000 02000000 00002001 00000100 00000850 00280004 40008000 00008022 08100000 00000040 10080008 00040000 02000000 08000000 80020000 40000100 08020e28 20022000 00400004 00140000 80000000 00040000 00000080 20428000 00060001 c0000000 00004000 |