On Target TRPV1_RAT 0.49484536/CHEMBL430173
For the given ligand Icatibant, we have found in our database that, being scored 0.49484536, the most similar ligand is CHEMBL430173. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL430173 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | N[C@@H](CCCNC(=N)N)C(=O)N[C@H]1C[C@H](N(Cc2ccc(Cl)cc2Cl)C1)C(=O)NCCc3ccc(Cl)cc3Cl |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00038000 01003400 00110100 04010e00 00000000 00000030 00000000 2200300c 00200280 000909e2 08200000 4003b900 06009876 00002401 80000400 00100000 00000000 02000000 00000000 00000201 00000c00 382d8720 00000003 83500018 00002000 c0000200 40040000 90000100 0c000110 00060013 a80c4000 00822600 |