On Target TRPV1_RAT 0.18095239/CHEMBL2029639
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.18095239, the most similar ligand is CHEMBL2029639. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL2029639 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CC(C)(C)C(=O)OCC(NC(=S)NCc1ccc(NS(=O)(=O)C)cc1)c2ccc(cc2)C(C)(C)C |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000052 00000800 00000302 80310e00 000000c0 00000000 00000004 22003040 00001100 00080840 09202004 40009800 80008c00 00000001 800c1048 000a0008 28064000 02000000 04000040 00004200 40010120 08218a00 33000000 00400010 10000480 80000000 00000000 a000000c 01200300 00060002 00040000 80010668 |