On Target FABP5_HUMAN 0.24886878/CHEMBL245284
For the given ligand Nefazodone, we have found in our database that, being scored 0.24886878, the most similar ligand is CHEMBL245284. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL245284 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CCn1c(nc(c2ccccc2)c1c3ccccc3)c4ccccc4c5cccc(OCC(=O)O)c5 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0400e002 40000009 20100108 10010610 20081040 00002008 02000200 00081040 00000100 100018d0 00048088 4000c800 03809002 00380080 61220081 800c000e 04020040 82002000 04480000 40421200 81100000 38000a00 35003000 08400000 10040001 c1080000 00000208 10801050 00014205 00660800 40481824 00000008 |