On Target FABP5_HUMAN 0.28164557/CHEMBL3938613
For the given ligand Icatibant, we have found in our database that, being scored 0.28164557, the most similar ligand is CHEMBL3938613. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL3938613 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | Cc1nsc(n1)c2c(C)c(sc2NC(=O)C3=C(C4CCC3CC4)C(=O)O)C5CC5 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 0043c212 01028800 40100900 41001e02 64381002 00082540 c1088180 18a02772 01001901 00580093 04398304 e0011ce8 0f828118 01b18001 80123401 0038010e 61040000 16002138 3a632018 01004005 00100908 5b080f90 6110e009 00534010 12245080 0c218e03 00c14010 90001484 00010114 222e0003 2c020800 00e50611 |