On Target PAR1_HUMAN 0.38157895/CHEMBL80623
For the given ligand Balsalazide, we have found in our database that, being scored 0.38157895, the most similar ligand is CHEMBL80623. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL80623 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | OC(=O)C[C@H](NC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2)c3cnc4ccccc4c3 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 10010002 0180d400 00104100 00810610 00041000 00000000 00006000 22001000 00400800 000809e0 09300004 50019000 0c00881a 00400800 00000440 000c000c 00020000 02000005 00e02418 00000201 c0000100 181c8e38 218000c0 80500018 00041801 c0000000 08000000 90000000 00400100 00060013 20040000 80002600 |