On Target PAR1_HUMAN 0.31417623/CHEMBL3704471
For the given ligand Nefazodone, we have found in our database that, being scored 0.31417623, the most similar ligand is CHEMBL3704471. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3704471 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CCN(CC)C1=NN2C(=N)N(CC(=O)c3cc(OCCCO)c(OC)c(c3)C(C)(C)C)N=C2C(=C1C)C |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0400500f 42801e09 68000199 10250610 00085085 8200c44c 46840000 00600200 01000300 11080ad0 0824400c 6800a000 0480d006 28200080 01024081 2a0ce00c 10048000 c2800008 09680000 40260604 c0100020 1c038260 23800843 83608014 20170c00 c0008000 60120018 009010c0 04000309 0806200a c0080384 00008760 |