On Target PAR1_HUMAN 0.54285717/CHEMBL4065100
For the given ligand Icatibant, we have found in our database that, being scored 0.54285717, the most similar ligand is CHEMBL4065100. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL4065100 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00010000 01003200 00100100 04010e00 00000000 00000000 00000000 2000200c 00200a80 000808c2 08300000 4003b000 16009012 00002001 80000000 001c0008 00000000 02000000 00800008 00000201 00000100 38250620 03000083 83500018 00000801 80000000 40000000 10000000 0c000010 0006000b a0084000 00002600 |