On Target PAR1_HUMAN 0.20491803/CHEMBL3658412
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.20491803, the most similar ligand is CHEMBL3658412. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3658412 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CCc1ccc(cc1)C2CC(CN(C2)C(=O)N3CCOCC3)OC(=O)Nc4ccccc4 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000012 01405008 00100302 80210f00 00100080 00000000 00000004 80002004 00100b84 000808c0 08382004 50018800 00009002 00300300 00081048 00180108 30068008 02800000 08400840 00400201 40000100 18250c10 33002042 81500018 00010400 80081002 00800200 10000081 04008200 80060003 00080000 00002e00 |