On Target SC6A4_HUMAN 0.44966444/CHEMBL91418
For the given ligand Alfentanil, we have found in our database that, being scored 0.44966444, the most similar ligand is CHEMBL91418. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL91418 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | Cc1cc(C)cc(OCC(=O)N(C2CCNCC2)c3ccc(Cl)c(Cl)c3)c1 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 0400e002 41001408 20101108 01010602 20001081 00000000 0a000000 00000000 00000000 000009e0 002c0004 5001c800 02808006 00100081 010a1041 00080008 10040000 82000000 08080000 00024201 60100000 180c0700 32002000 00400018 00002000 80100000 08080008 10000081 00008200 00060011 00000000 02020200 |