On Target MK01_HUMAN 0.38666666/CHEMBL3799370
For the given ligand Balsalazide, we have found in our database that, being scored 0.38666666, the most similar ligand is CHEMBL3799370. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3799370 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CC(CNC(=O)c1ccc2[nH]nc(c3ccncc3)c2c1)OCc4ccccc4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 0000200a 0000d808 a0104100 c0010600 01040090 00004002 02400000 02001000 00000100 00000840 00201004 60008000 80008812 00410000 00001408 020c200c 10220000 02000004 04600000 10220200 40000000 1c068628 32800800 0060401c 00100400 c0002000 108a0000 80000061 00004304 00060001 e0040400 00004220 |