On Target HYES_HUMAN 0.43410853/CHEMBL477046
For the given ligand Balsalazide, we have found in our database that, being scored 0.43410853, the most similar ligand is CHEMBL477046. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL477046 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | OC(=O)c1cc(NC(=O)NC23CC4CC(CC(C4)C2)C3)ccc1O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000006 01001808 20100100 00010e00 04000000 00024000 02000004 00002801 00000100 000008d0 00280004 40018000 00009022 08100000 00000040 10082008 00040000 02400000 0a002000 80020001 40000100 18070e30 20022000 0050001c 00150000 80000000 00040000 10000080 20428000 00060001 c00a0000 00004200 |