On Target HYES_HUMAN 0.3316062/CHEMBL3222131
For the given ligand Nefazodone, we have found in our database that, being scored 0.3316062, the most similar ligand is CHEMBL3222131. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3222131 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CS(=O)(=O)N1CCN(CCCCOc2cccc(NC(=O)CC34CC5CC(CC(C5)C3)C4)c2)CC1 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04014082 81000008 20100008 05310700 30101000 06002000 02020000 20000000 00000000 000008c0 00282004 40019000 0480800a 08102001 91020041 0008a008 00040080 00000000 0a602000 00026601 40100000 38000610 21002021 22100030 02000000 00000000 00000200 1000008c 08008200 00060001 00020000 00030a60 |