On Target TRPV3_HUMAN 0.34439835/CHEMBL3696387
For the given ligand Icatibant, we have found in our database that, being scored 0.34439835, the most similar ligand is CHEMBL3696387. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL3696387 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(C)[C@H](CO)NCc1nc(ccc1F)C2CCCN(C2)C(=O)OC(C)(C)C |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 0400009a 01401000 00104122 16000e00 000400a1 00108022 01000000 0200300d 00d00a80 000802c0 08318004 50818000 00008802 00201000 01020400 021e010d 12228200 0e0820a2 00600808 00100241 40200100 18258c50 23800000 a1500018 00101000 c0000002 00000040 90201081 04000304 00860003 a0040880 20006600 |