On Target TRPV3_HUMAN 0.2606383/CHEMBL3692258
For the given ligand Alfentanil, we have found in our database that, being scored 0.2606383, the most similar ligand is CHEMBL3692258. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL3692258 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CC(C)[C@H](CO)NCc1nc(ccc1F)c2cccc(c2)N3CCOCC3 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 0000609a 00000000 40105100 96010e00 008400a1 00180022 00400000 02083041 00000000 10000850 00250004 40008010 01000802 00001000 00021448 020c010d 12060200 02002022 0c600000 00500201 40100000 18018000 33800000 20400010 00140400 c0080000 08000240 800010c1 0040c304 00260400 20040800 20004200 |