On Target AMPN_HUMAN 0.30496454/CHEMBL2204950
For the given ligand Balsalazide, we have found in our database that, being scored 0.30496454, the most similar ligand is CHEMBL2204950. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2204950 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | COc1cccc(CNC(=O)N[C@@H](CC(C)C)C(=O)NO)c1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00010000 45803018 60100108 00010e00 00001000 00000000 06000004 02003020 00000000 000208c0 01200000 4001b000 0400b806 00000000 01000001 00000018 00004000 02000010 00080040 000e0201 80000100 38058600 00000000 00448018 00010000 80000000 00000000 90000000 08000300 00060005 200c4000 80400200 |