On Target AMPN_HUMAN 0.30939227/CHEMBL328470
For the given ligand Nefazodone, we have found in our database that, being scored 0.30939227, the most similar ligand is CHEMBL328470. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL328470 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CC(C)CN(CCCN1CCN(CCCNc2ccnc3cc(Cl)ccc23)CC1)C(=O)CC(=O)NO |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0001c002 00001410 40104000 04000600 200c0000 00000000 08008000 00000000 00000100 00000960 00200004 40009800 0a00880e 00402000 00020040 00040014 00040000 00000000 08200050 00040200 60100000 380c8708 20800021 82000018 00007000 00000000 00008000 00000080 08008000 00060015 00040000 00422240 |