On Target AMPN_HUMAN 0.26666668/CHEMBL3298947
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL3298947. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3298947 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CCOC[C@H]([NH3+])CS.[O-]C(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000000 00000000 00100000 80110400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40008000 00008000 00040000 00001000 00080008 00400000 00000000 00000000 00000004 00000020 00000a00 03000400 00400010 00000400 00000000 00000000 90000000 00000200 00040000 00000000 03010280 |