On Target AOFA_HUMAN 0.40397352/CHEMBL3407586
For the given ligand Balsalazide, we have found in our database that, being scored 0.40397352, the most similar ligand is CHEMBL3407586. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3407586 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCOC(=O)c1cc2cc(OCCCC3CCN(Cc4ccccc4)CC3)ccc2[nH]1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04000002 01000808 22100108 10010700 000c1030 02004000 06080000 22001000 00000300 000008c0 00280004 50018000 00808806 00d10000 11020441 020c200c 00828000 02800004 00602000 00420201 40000000 18068a78 a1802002 80500114 00002400 c0002000 00080000 90000000 00000304 00060401 e0040200 00000200 |