On Target AOFA_HUMAN 0.32978722/CHEMBL4089754
For the given ligand Nefazodone, we have found in our database that, being scored 0.32978722, the most similar ligand is CHEMBL4089754. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL4089754 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | Cn1cc2cc(ccc2n1)C(=O)Nc3ccc(F)c(Cl)c3 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000c006 00008c08 20100100 03010600 010c0000 00000010 0a000000 02001000 00000000 000008c0 00280004 4001c800 02008806 00501001 00000040 000c000c 00040000 02000004 08600000 00224200 40100000 1c078718 20812800 02600004 00102000 80001000 00000000 80000081 00008100 00068041 80040000 00024220 |