On Target AOFA_HUMAN 0.23469388/CHEMBL3780524
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.23469388, the most similar ligand is CHEMBL3780524. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3780524 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | Cl.N[C@@H]1C[C@H]1c2ccc(NC(=O)c3ccc(cc3)N4CCOC4=O)cc2 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00004002 00404a00 00001300 c0010600 00000080 00000000 00000000 02001000 00000a04 000808c0 083c0004 4000c000 00008800 01108000 00001040 00180008 00068000 02800000 08000800 00400001 40100100 18028e10 32012002 8140001c 00000000 80000002 18000000 80000080 04008300 8006000b 80040000 00020600 |