On Target AOFA_HUMAN 0.37435898/CHEMBL394864
For the given ligand Alfentanil, we have found in our database that, being scored 0.37435898, the most similar ligand is CHEMBL394864. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL394864 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | Fc1cc(ccc1c2cccnc2)N3C[C@H](Cn4ccnn4)OC3=O |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00006002 00405818 6010530c 02010610 201c1180 04008018 0c000000 00000000 14202204 110049c0 002c2004 e0018808 00018804 00949300 00421040 801c800c 00368200 02800004 0c600800 00440002 60120000 180a8c90 33803002 0c400018 00240001 80080002 18000200 000000d1 0040c200 80068011 80000000 04008a00 |