On Target ADRB2_HUMAN 0.46923077/CHEMBL1459608
For the given ligand Balsalazide, we have found in our database that, being scored 0.46923077, the most similar ligand is CHEMBL1459608. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL1459608 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCCCC(=O)Nc1ccc(cc1)C(=O)N2CCCC(C2)C(=O)OCC |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00014002 01001800 00100100 80010700 20080000 00002000 00000000 22001000 00000000 000008c0 00280004 50019000 0c008812 01188000 00020440 00081008 00a60000 02000001 08c00010 00000201 40100020 18168e00 21002080 0050001c 00001401 c0000000 00000000 90000080 00008300 00060001 a0040000 00002200 |