On Target ADRB2_HUMAN 0.40397352/CHEMBL1459608
For the given ligand Alfentanil, we have found in our database that, being scored 0.40397352, the most similar ligand is CHEMBL1459608. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL1459608 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCCCC(=O)Nc1ccc(cc1)C(=O)N2CCCC(C2)C(=O)OCC |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00014002 01001800 00100100 80010700 20080000 00002000 00000000 22001000 00000000 000008c0 00280004 50019000 0c008812 01188000 00020440 00081008 00a60000 02000001 08c00010 00000201 40100020 18168e00 21002080 0050001c 00001401 c0000000 00000000 90000080 00008300 00060001 a0040000 00002200 |