On Target PPARG_HUMAN 0.39285713/CHEMBL2336644
For the given ligand Balsalazide, we have found in our database that, being scored 0.39285713, the most similar ligand is CHEMBL2336644. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2336644 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | Cc1ccc(CNCCCN(Cc2ccc(cc2)C(=O)O)Cc3cc(cc(c3)C(F)(F)F)C(F)(F)F)cc1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000000 000a0c00 00100100 40050600 00000001 00004000 10000400 02001000 00000100 00000970 00200000 40008002 80008802 01000000 00000400 00080008 00002000 02000000 00000000 00000200 00000000 18028a20 00000000 00400014 00000000 c0000000 08000000 90000000 00000100 00060010 e0140000 00000200 |