On Target PPARG_HUMAN 0.42523363/CHEMBL2208197
For the given ligand Icatibant, we have found in our database that, being scored 0.42523363, the most similar ligand is CHEMBL2208197. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL2208197 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | NC(=N)NCCC[C@@H](NC(=O)C(=O)c1c[nH]c2cc(O)ccc12)C(=O)O |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00018002 01805808 20100100 41010e10 000c1080 00000000 06002000 20002004 04600280 000908c2 08202004 4003b000 17009812 01400002 c0080040 001c000c 10000000 02000004 00600400 00060201 c0000000 18278e08 23800000 9150001c 00042000 80000000 48000000 10000000 04000010 00060003 a00c6200 00202620 |