On Target PPARG_HUMAN 0.40462428/CHEMBL177854
For the given ligand Alfentanil, we have found in our database that, being scored 0.40462428, the most similar ligand is CHEMBL177854. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL177854 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCCCCN1C(=O)C(CCOc2ccccc2CC(=O)O)Oc3ccccc13 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 04046002 01001008 20101108 00010702 a01010c0 82002000 02000000 28008200 00030000 010808c0 082c0004 4001d100 05808002 00100000 510e1041 00086408 18040000 a2008100 09400000 00020201 41100000 18040e00 33402000 02508018 00000000 c0000400 28000248 10000081 00008300 00060003 00002400 00002e00 |