On Target CASP1_HUMAN 0.1980198/CHEMBL430648
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.1980198, the most similar ligand is CHEMBL430648. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL430648 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CC(C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)C)C(=O)N[C@H]1CC(=O)OC1O |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00070000 01007000 00100300 84010e00 00380080 00000000 00000800 20000008 00000000 000200a0 00200000 4001b000 0e008032 01002001 80181008 00280008 10260000 00000001 00c00010 00000201 00000000 30140e00 13000083 02100018 00001401 00000000 00800000 30000001 08000202 00040001 20404000 00802a00 |