On Target CHLE_HUMAN 0.41221374/CHEMBL544592
For the given ligand Balsalazide, we have found in our database that, being scored 0.41221374, the most similar ligand is CHEMBL544592. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL544592 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | Cl.CNC(=O)Oc1cccc(CN(C)CCCOc2ccc(cc2)C(=O)c3ccccc3)c1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04000000 44000808 60100109 00010600 00001000 02000000 02040000 03001000 04000200 00080840 08200000 40008000 00808a02 00000000 01010401 00182008 00220000 02000000 00880000 00020200 00000000 18028e10 11000080 0044a014 00000001 e0010002 00120000 c0000000 00000380 00060003 a0040000 10020640 |