On Target CHLE_HUMAN 0.2840909/CHEMBL480176
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.2840909, the most similar ligand is CHEMBL480176. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL480176 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CCN(CC)CCOC(=O)N1c2ccccc2Sc3ccccc13 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000002 00c00200 00020200 08108600 00040080 00002000 00000010 00000000 00002204 00000840 00282004 60008000 00008002 00100200 20001040 0018000a 14069000 20800000 08200802 02400000 c0000000 08000c10 32802002 00080009 00004000 00080002 02200010 08000081 00008200 81060001 0000a000 00010220 |